--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The PubChem CID of the compound is 16717704.
The molecular formula of the compound is C45H36FeN2.
The molecular weight of the compound is 660.6 g/mol.
The IUPAC name of the compound is N,N-dimethyl-6H-cyclopenta[b]pyridin-6-id-4-amine;iron;(2,3,4,5-tetraphenylcyclopentyl)benzene.
The InChI of the compound is InChI=1S/C35H25.C10H11N2.Fe/c1-6-16-26(17-7-1)31-32(27-18-8-2-9-19-27)34(29-22-12-4-13-23-29)35(30-24-14-5-15-25-30)33(31)28-20-10-3-11-21-28;1-12(2)10-6-7-11-9-5-3-4-8(9)10;/h1-25H;3-7H,1-2H3;/q-5;-1.
The InChIKey of the compound is YOELKGUVMFIZHG-UHFFFAOYSA-N.
The canonical SMILES of the compound is CN(C)C1=CC=NC2=C[CH-]C=C21.C1=CC=C(C=C1)[C-]2[C-]([C-]([C-]([C-]2C3=CC=CC=C3)C4=CC=CC=C4)C5=CC=CC=C5)C6=CC=CC=C6.[Fe].
The compound has 0 hydrogen bond donor counts.
The compound has 8 hydrogen bond acceptor counts.
The compound has 6 rotatable bond counts.