(S)-(+)-2-Hydroxy-2-phenylpropionic acid

• Catalog Number: ACMA00000505
• Category: Alcohols
• Molecular Weight: 166.17
• Molecular Formula: C₉H₉F₃O
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (S)-(+)-2-Hydroxy-2-phenylpropionic acid?

The molecular formula of (S)-(+)-2-Hydroxy-2-phenylpropionic acid is C9H10O3.

How is (S)-(+)-2-Hydroxy-2-phenylpropionic acid also known as?

(S)-(+)-2-Hydroxy-2-phenylpropionic acid is also known as (s)-atrolactic acid.

What is the molecular weight of (S)-(+)-2-Hydroxy-2-phenylpropionic acid?

The molecular weight of (S)-(+)-2-Hydroxy-2-phenylpropionic acid is 166.17 g/mol.

What is the IUPAC name of (S)-(+)-2-Hydroxy-2-phenylpropionic acid?

The IUPAC name of (S)-(+)-2-Hydroxy-2-phenylpropionic acid is (2S)-2-hydroxy-2-phenylpropanoic acid.

What is the InChI of (S)-(+)-2-Hydroxy-2-phenylpropionic acid?

The InChI of (S)-(+)-2-Hydroxy-2-phenylpropionic acid is InChI=1S/C9H10O3/c1-9(12,8(10)11)7-5-3-2-4-6-7/h2-6,12H,1H3,(H,10,11)/t9-/m0/s1.

What is the InChIKey of (S)-(+)-2-Hydroxy-2-phenylpropionic acid?

The InChIKey of (S)-(+)-2-Hydroxy-2-phenylpropionic acid is NWCHELUCVWSRRS-VIFPVBQESA-N.

What is the canonical SMILES of (S)-(+)-2-Hydroxy-2-phenylpropionic acid?

The canonical SMILES of (S)-(+)-2-Hydroxy-2-phenylpropionic acid is CC(C1=CC=CC=C1)(C(=O)O)O.

How many hydrogen bond donor counts are there in (S)-(+)-2-Hydroxy-2-phenylpropionic acid?

There are 2 hydrogen bond donor counts in (S)-(+)-2-Hydroxy-2-phenylpropionic acid.

How many hydrogen bond acceptor counts are there in (S)-(+)-2-Hydroxy-2-phenylpropionic acid?

There are 3 hydrogen bond acceptor counts in (S)-(+)-2-Hydroxy-2-phenylpropionic acid.

What is the topological polar surface area of (S)-(+)-2-Hydroxy-2-phenylpropionic acid?

The topological polar surface area of (S)-(+)-2-Hydroxy-2-phenylpropionic acid is 57.5Ų.