(R,Z)-5-(1-Decenyl)dihydrofuran-2(3H)-one

• CAS: 64726-91-6
• Catalog Number: ACM64726916
• Category: Other Products
• Molecular Weight: 224.33916
• Molecular Formula: C₁₄H₂₄O₂
• Synonyms: (R,Z)-5-(1-decenyl)dihydrofuran-2(3H)-one;JAPONLURE;Japonilure;NURANONE;(5R)-5α-[(Z)-1-Decenyl]-4,5-dihydrofuran-2(3H)-one;(R)-5-[(Z)-1-Decenyl]dihydro-2(3H)-furanone;(R)-Japonilure;[5R,(-)]-5-((Z)-1-Decenyl)-4,5-dihydrofuran-2(3H)-one

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C14H24O2.

What is the molecular weight of the compound?

The molecular weight is 224.34 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is (5R)-5-[(Z)-dec-1-enyl]oxolan-2-one.

What is the InChI of the compound?

The InChI is InChI=1S/C14H24O2/c1-2-3-4-5-6-7-8-9-10-13-11-12-14(15)16-13/h9-10,13H,2-8,11-12H2,1H3/b10-9-/t13-/m0/s1.

What is the InChIKey of the compound?

The InChIKey is QTGIYXFCSKXKMO-XPSMFNQNSA-N.

What are the synonyms of the compound?

The synonyms are Japonilure, Nuranone, and Bag-A-Bug.

What is the CAS number of the compound?

The CAS number is 64726-91-6.

How many hydrogen bond donor counts does the compound have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

It has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

It has 8 rotatable bond counts.