(R)-BoroVal-(+)-Pinanediol-CF3CO2H

• CAS: 94242-81-6
• Catalog Number: ACM94242816
• Category: Boro-Amino Acids
• Molecular Weight: 365.20
• Molecular Formula: C₁₄H₂₆BNO₂.C₂HF₃O₂

Custom Q&A

What is the molecular formula of (R)-BoroVal-(+)-Pinanediol-CF3CO2H?

The molecular formula is C14H23BF3NO4.

What is the PubChem CID of (R)-BoroVal-(+)-Pinanediol-CF3CO2H?

The PubChem CID is 72662688.

What is the molecular weight of (R)-BoroVal-(+)-Pinanediol-CF3CO2H?

The molecular weight is 337.14 g/mol.

What is the IUPAC name of (R)-BoroVal-(+)-Pinanediol-CF3CO2H?

The IUPAC name is 2,2,2-trifluoroacetic acid;1-(2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.0 2,6 ]decan-4-yl)ethanamine.

What is the InChI of (R)-BoroVal-(+)-Pinanediol-CF3CO2H?

The InChI is InChI=1S/C12H22BNO2.C2HF3O2/c1-7(14)13-15-10-6-8-5-9(11(8,2)3)12(10,4)16-13;3-2(4,5)1(6)7/h7-10H,5-6,14H2,1-4H3;(H,6,7).

What is the InChIKey of (R)-BoroVal-(+)-Pinanediol-CF3CO2H?

The InChIKey is UIRPOZKMSMHJBQ-UHFFFAOYSA-N.

What is the canonical SMILES of (R)-BoroVal-(+)-Pinanediol-CF3CO2H?

The canonical SMILES is B1(OC2CC3CC(C3(C)C)C2(O1)C)C(C)N.C(=O)(C(F)(F)F)O.

How many hydrogen bond donor counts does (R)-BoroVal-(+)-Pinanediol-CF3CO2H have?

It has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does (R)-BoroVal-(+)-Pinanediol-CF3CO2H have?

It has 8 hydrogen bond acceptor counts.

How many rotatable bond counts does (R)-BoroVal-(+)-Pinanediol-CF3CO2H have?

It has 1 rotatable bond count.