(R)-3-Amino-3-(4-bromophenyl)propionic acid

• CAS: 479074-63-0
• Catalog Number: ACM479074630
• Category: Bromine Series

Custom Q&A

What is the molecular formula of (R)-3-Amino-3-(4-bromophenyl)propionic acid?

The molecular formula is C9H10BrNO2.

When was (R)-3-Amino-3-(4-bromophenyl)propionic acid created and modified?

It was created on July 8, 2005, and last modified on December 2, 2023.

What is the IUPAC name of (R)-3-Amino-3-(4-bromophenyl)propionic acid?

The IUPAC name is (3R)-3-amino-3-(4-bromophenyl)propanoic acid.

What is the InChI code of (R)-3-Amino-3-(4-bromophenyl)propionic acid?

The InChI code is InChI=1S/C9H10BrNO2/c10-7-3-1-6(2-4-7)8(11)5-9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m1/s1.

What is the molecular weight of (R)-3-Amino-3-(4-bromophenyl)propionic acid?

The molecular weight is 244.08 g/mol.

How many hydrogen bond donor counts does (R)-3-Amino-3-(4-bromophenyl)propionic acid have?

It has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does (R)-3-Amino-3-(4-bromophenyl)propionic acid have?

It has 3 hydrogen bond acceptor counts.

What is the XLogP3 value of (R)-3-Amino-3-(4-bromophenyl)propionic acid?

The XLogP3 value is -0.7.

What is the topological polar surface area of (R)-3-Amino-3-(4-bromophenyl)propionic acid?

The topological polar surface area is 63.3Ų.

Is (R)-3-Amino-3-(4-bromophenyl)propionic acid the canonicalized form?

Yes, it is the canonicalized form.