CAS
21190-88-5 Purity
---
21190-88-5 Purity
---
Inquiry Basket
(R)-1-Bromo-2-propanol
CAS
113429-86-0
Catalog Number
ACM113429860
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 1-bromo-2-propanol?
The molecular formula of 1-bromo-2-propanol is C3H7BrO.
What is the molecular weight of 1-bromo-2-propanol?
The molecular weight of 1-bromo-2-propanol is 138.99 g/mol.
What is the IUPAC name of 1-bromo-2-propanol?
The IUPAC name of 1-bromo-2-propanol is 1-bromopropan-2-ol.
What is the InChI for 1-bromo-2-propanol?
The InChI for 1-bromo-2-propanol is InChI=1S/C3H7BrO/c1-3(5)2-4/h3,5H,2H2,1H3.
What is the InChIKey for 1-bromo-2-propanol?
The InChIKey for 1-bromo-2-propanol is WEGOLYBUWCMMMY-UHFFFAOYSA-N.
What is the CAS number of 1-bromo-2-propanol?
The CAS number of 1-bromo-2-propanol is 19686-73-8.
How many hydrogen bond donor count does 1-bromo-2-propanol have?
1-bromo-2-propanol has 1 hydrogen bond donor count.
How many hydrogen bond acceptor count does 1-bromo-2-propanol have?
1-bromo-2-propanol has 1 hydrogen bond acceptor count.
How many rotatable bond count does 1-bromo-2-propanol have?
1-bromo-2-propanol has 1 rotatable bond count.
What is the topological polar surface area of 1-bromo-2-propanol?
The topological polar surface area of 1-bromo-2-propanol is 20.2Ų.
Recommended Products
![5-Bromo-4-chloro-7H-pyrrolo[2,3-d]pyrimidine](https://resource.alfa-chemistry.com/structure/22276-95-5.gif)
