168267-99-0 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C7H6BF3O3.
The molecular weight of the compound is 205.93 g/mol.
The IUPAC name of the compound is [2-(trifluoromethoxy)phenyl]boronic acid.
The InChI of the compound is InChI=1S/C7H6BF3O3/c9-7(10,11)14-6-4-2-1-3-5(6)8(12)13/h1-4,12-13H.
The InChIKey of the compound is AIJCNTOYZPKURP-UHFFFAOYSA-N.
The canonical SMILES of the compound is B(C1=CC=CC=C1OC(F)(F)F)(O)O.
The CAS number of the compound is 175676-65-0.
The European Community (EC) number of the compound is 642-456-9.
The DSSTox Substance ID of the compound is DTXSID60380411.
The topological polar surface area of the compound is 49.7Ų.