26145-14-2 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of sorbic chloride is C6H7ClO.
The molecular weight of sorbic chloride is 130.57 g/mol.
The IUPAC name of sorbic chloride is (2E,4E)-hexa-2,4-dienoyl chloride.
The InChI of sorbic chloride is InChI=1S/C6H7ClO/c1-2-3-4-5-6(7)8/h2-5H,1H3/b3-2+,5-4+.
The InChIKey of sorbic chloride is GRTWTVFDPBKQNU-MQQKCMAXSA-N.
The canonical SMILES of sorbic chloride is CC=CC=CC(=O)Cl.
The XLogP3 value of sorbic chloride is 2.3.
Sorbic chloride has 0 hydrogen bond donor counts.
Sorbic chloride has 1 hydrogen bond acceptor count.