205503-61-3 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The chemical formula of sodium hexafluoroacetylacetonate is C5HF6NaO2.
The molecular weight of sodium hexafluoroacetylacetonate is 230.04 g/mol.
The IUPAC name of sodium hexafluoroacetylacetonate is sodium;(Z)-1,1,1,5,5,5-hexafluoro-4-oxopent-2-en-2-olate.
The Canonical SMILES of sodium hexafluoroacetylacetonate is C(=C(C(F)(F)F)[O-])C(=O)C(F)(F)F.[Na+].
The CAS number of sodium hexafluoroacetylacetonate is 22466-49-5.
The molecular weight of sodium in sodium hexafluoroacetylacetonate is not mentioned in the reference.
There are 0 hydrogen bond donor atoms in sodium hexafluoroacetylacetonate.
There are 8 hydrogen bond acceptor atoms in sodium hexafluoroacetylacetonate.
There is 1 rotatable bond in sodium hexafluoroacetylacetonate.
The topological polar surface area of sodium hexafluoroacetylacetonate is 40.1Ų.