CAS
1072946-20-3 Purity
---
1072946-20-3 Purity
---
Inquiry Basket
(R)-Boropro-(+)-Pinanediol-Hcl
CAS
147208-69-3
Catalog Number
ACM147208693
Category
Boro-Amino Acids
Molecular Weight
285.62 g/mol
Molecular Formula
C14H25BClNO2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Synonyms
(R)-Boropro-(+)-Pinanediol-HydrCHloride(R)-2-PyrrolidineboronicacidpinanediolesterhydrCHloride
What is the molecular weight of (R)-BoroPro-(+)-Pinanediol-HCl?
The molecular weight of (R)-BoroPro-(+)-Pinanediol-HCl is 285.62 g/mol.
What is the IUPAC name of (R)-BoroPro-(+)-Pinanediol-HCl?
The IUPAC name of (R)-BoroPro-(+)-Pinanediol-HCl is (2R)-2-[(1S,2S,6R,8S)-2,9,9-trimethyl-3,5-dioxa-4-boratricyclo[6.1.1.02,6]decan-4-yl]pyrrolidine hydrochloride.
What is the InChI key of (R)-BoroPro-(+)-Pinanediol-HCl?
The InChI key of (R)-BoroPro-(+)-Pinanediol-HCl is OVVMNBVQOPZMPY-AKDYBRCWSA-N.
What is the canonical SMILES of (R)-BoroPro-(+)-Pinanediol-HCl?
The canonical SMILES of (R)-BoroPro-(+)-Pinanediol-HCl is B1(OC2CC3CC(C3(C)C)C2(O1)C)C4CCCN4.Cl.
What is the CAS number of (R)-BoroPro-(+)-Pinanediol-HCl?
The CAS number of (R)-BoroPro-(+)-Pinanediol-HCl is 147208-69-3.
What is the European Community (EC) number of (R)-BoroPro-(+)-Pinanediol-HCl?
The European Community (EC) number of (R)-BoroPro-(+)-Pinanediol-HCl is 604-578-0.
What is the UNII of (R)-BoroPro-(+)-Pinanediol-HCl?
The UNII of (R)-BoroPro-(+)-Pinanediol-HCl is J6V3ET5R6W.
What is the hydrogen bond donor count of (R)-BoroPro-(+)-Pinanediol-HCl?
The hydrogen bond donor count of (R)-BoroPro-(+)-Pinanediol-HCl is 2.
What is the hydrogen bond acceptor count of (R)-BoroPro-(+)-Pinanediol-HCl?
The hydrogen bond acceptor count of (R)-BoroPro-(+)-Pinanediol-HCl is 3.
What is the rotatable bond count of (R)-BoroPro-(+)-Pinanediol-HCl?
The rotatable bond count of (R)-BoroPro-(+)-Pinanediol-HCl is 1.
Recommended Products
