N-octylpyridinium bis((trifluoromethyl)sulfonyl)imide

• CAS: 384347-06-2
• Catalog Number: ACM384347062
• Category: Pyridinium Ionic Liquids
• Molecular Weight: 472.469
• Molecular Formula: C15H22O4N2S2F6
• Abbreviation: OpyNTF2
• Chemical Formula: [Opy]NTF2

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is bis(trifluoromethylsulfonyl)azanide;1-octylpyridin-1-ium.

What is the molecular weight of the compound?

The molecular weight of the compound is 472.5 g/mol.

What is the molecular formula of the compound?

The molecular formula of the compound is C15H22F6N2O4S2.

What is the InChIKey of the compound?

The InChIKey of the compound is REYBKXICDFBMEW-UHFFFAOYSA-N.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CCCCCCCC[N+]1=CC=CC=C1.C(F)(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 11 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 9 rotatable bond counts.

What is the exact mass of the compound?

The exact mass of the compound is 472.09251851 g/mol.

Is the compound canonicalized?

Yes, the compound is canonicalized.