CAS
74440-81-6 Purity
≥98%
74440-81-6 Purity
≥98%
Inquiry Basket
N-hexyl-3-metylpyridinium chloride
CAS
916730-40-0
Catalog Number
ACM916730400
Category
Pyridinium Ionic Liquids
Molecular Weight
213.74
Molecular Formula
C12H20ClN
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Abbreviation
H3MePyCl
Chemical Formula
H3MePyCl
What is the molecular formula of N-hexyl-3-metylpyridinium chloride?
The molecular formula of N-hexyl-3-metylpyridinium chloride is C12H20ClN.
What is the molecular weight of N-hexyl-3-metylpyridinium chloride?
The molecular weight of N-hexyl-3-metylpyridinium chloride is 213.75 g/mol.
What is the IUPAC name of N-hexyl-3-metylpyridinium chloride?
The IUPAC name of N-hexyl-3-metylpyridinium chloride is 1-hexyl-3-methylpyridin-1-ium; chloride.
What is the InChI key of N-hexyl-3-metylpyridinium chloride?
The InChI key of N-hexyl-3-metylpyridinium chloride is KBIWQQMYCIVDLV-UHFFFAOYSA-M.
What is the canonical SMILES of N-hexyl-3-metylpyridinium chloride?
The canonical SMILES of N-hexyl-3-metylpyridinium chloride is CCCCCC[N+]1=CC=CC(=C1)C.[Cl-].
What is the hydrogen bond donor count of N-hexyl-3-metylpyridinium chloride?
The hydrogen bond donor count of N-hexyl-3-metylpyridinium chloride is 0.
What is the hydrogen bond acceptor count of N-hexyl-3-metylpyridinium chloride?
The hydrogen bond acceptor count of N-hexyl-3-metylpyridinium chloride is 1.
What is the rotatable bond count of N-hexyl-3-metylpyridinium chloride?
The rotatable bond count of N-hexyl-3-metylpyridinium chloride is 5.
What is the topological polar surface area of N-hexyl-3-metylpyridinium chloride?
The topological polar surface area of N-hexyl-3-metylpyridinium chloride is 3.9.
Is N-hexyl-3-metylpyridinium chloride a canonicalized compound?
Yes, N-hexyl-3-metylpyridinium chloride is a canonicalized compound.
Recommended Products
