3233-49-6 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name is decyl(triphenyl)phosphanium;bromide.
The molecular formula is C28H36BrP.
The exact mass is 482.17380.
There are 30 heavy atoms in the compound.
The compound has 12 rotatable bonds.
There are 2 covalently-bonded units.
No, the compound does not have any defined atom stereocenters.
The Canonical SMILES representation is CCCCCCCCCC[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-]
The CAS number is 32339-43-8.
A common synonym for the compound is Decyltriphenylphosphonium bromide.