What is the molecular formula of (4-Methoxycarbonylmethylphenyl)boronic acid pinacol ester?
The molecular formula is C15H21BO4.
What is the molecular weight of (4-Methoxycarbonylmethylphenyl)boronic acid pinacol ester?
The molecular weight is 276.14 g/mol.
What is the IUPAC name of (4-Methoxycarbonylmethylphenyl)boronic acid pinacol ester?
The IUPAC name is methyl 2-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]acetate.
What is the InChI Key of (4-Methoxycarbonylmethylphenyl)boronic acid pinacol ester?
The InChI Key is NBPODFADVLNXKO-UHFFFAOYSA-N.
What is the Canonical SMILES of (4-Methoxycarbonylmethylphenyl)boronic acid pinacol ester?
The Canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC(=O)OC.
What is the CAS number of (4-Methoxycarbonylmethylphenyl)boronic acid pinacol ester?
The CAS number is 454185-98-9.
How many hydrogen bond donor counts does (4-Methoxycarbonylmethylphenyl)boronic acid pinacol ester have?
It has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does (4-Methoxycarbonylmethylphenyl)boronic acid pinacol ester have?
It has 4 hydrogen bond acceptor counts.
What is the topological polar surface area of (4-Methoxycarbonylmethylphenyl)boronic acid pinacol ester?
The topological polar surface area is 44.8 Ų.
Is the compound of (4-Methoxycarbonylmethylphenyl)boronic acid pinacol ester canonicalized?
Yes, the compound is canonicalized.