What is the molecular formula of Ethyl 2-((tert-butoxycarbonylamino)methyl)thiazole-4-carboxylate?
The molecular formula is C12H18N2O4S.
What is the molecular weight of Ethyl 2-((tert-butoxycarbonylamino)methyl)thiazole-4-carboxylate?
The molecular weight is 286.35 g/mol.
What is the IUPAC name of Ethyl 2-((tert-butoxycarbonylamino)methyl)thiazole-4-carboxylate?
The IUPAC name is ethyl 2-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]-1,3-thiazole-4-carboxylate.
What is the InChI of Ethyl 2-((tert-butoxycarbonylamino)methyl)thiazole-4-carboxylate?
The InChI is InChI=1S/C12H18N2O4S/c1-5-17-10(15)8-7-19-9(14-8)6-13-11(16)18-12(2,3)4/h7H,5-6H2,1-4H3,(H,13,16).
What is the InChIKey of Ethyl 2-((tert-butoxycarbonylamino)methyl)thiazole-4-carboxylate?
The InChIKey is IIBLNWWFRAOZDR-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 2-((tert-butoxycarbonylamino)methyl)thiazole-4-carboxylate?
The canonical SMILES is CCOC(=O)C1=CSC(=N1)CNC(=O)OC(C)(C)C.
What is the CAS number of Ethyl 2-((tert-butoxycarbonylamino)methyl)thiazole-4-carboxylate?
The CAS number is 96929-05-4.
What is the XLogP3-AA value of Ethyl 2-((tert-butoxycarbonylamino)methyl)thiazole-4-carboxylate?
The XLogP3-AA value is 2.
What is the hydrogen bond donor count of Ethyl 2-((tert-butoxycarbonylamino)methyl)thiazole-4-carboxylate?
The hydrogen bond donor count is 1.
What is the hydrogen bond acceptor count of Ethyl 2-((tert-butoxycarbonylamino)methyl)thiazole-4-carboxylate?
The hydrogen bond acceptor count is 6.