CAS
1256633-17-6 Purity
---
1256633-17-6 Purity
---
Inquiry Basket
Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate
CAS
1256633-25-6
Catalog Number
ACM1256633256
Category
Other Products
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate?
The molecular formula is C15H13N5O4.
What are some synonyms for Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate?
Some synonyms include Ethyl 2-Nitro-4,5-di(1H-pyrazol-1-yl)benzoate and ethyl 2-nitro-4,5-di(pyrazol-1-yl)benzoate.
What is the molecular weight of Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate?
The molecular weight is 327.29 g/mol.
What is the IUPAC name of Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate?
The IUPAC name is ethyl 2-nitro-4,5-di(pyrazol-1-yl)benzoate.
What is the InChI of Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate?
The InChI is InChI=1S/C15H13N5O4/c1-2-24-15(21)11-9-13(18-7-3-5-16-18)14(10-12(11)20(22)23)19-8-4-6-17-19/h3-10H,2H2,1H3.
What is the InChIKey of Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate?
The InChIKey is VGSVCOTZKCUFSO-UHFFFAOYSA-N.
What is the canonical SMILES of Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate?
The canonical SMILES is CCOC(=O)C1=CC(=C(C=C1[N+](=O)[O-])N2C=CC=N2)N3C=CC=N3.
What is the XLogP3-AA value of Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate?
The XLogP3-AA value is 1.9.
How many hydrogen bond donor counts does Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate have?
Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate has 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate have?
Ethyl 2-nitro-4,5-di(1-pyrazolyl)benzoate has 6 hydrogen bond acceptor counts.
Recommended Products
