What is the molecular formula of 1,3-Divinyl-1,1,3,3-tetramethyldisilazane?
The molecular formula is C8H19NSi2.
What is the molecular weight of 1,3-Divinyl-1,1,3,3-tetramethyldisilazane?
The molecular weight is 185.41 g/mol.
What is the IUPAC name of 1,3-Divinyl-1,1,3,3-tetramethyldisilazane?
The IUPAC name is [[[ethenyl(dimethyl)silyl]amino]-dimethylsilyl]ethene.
What is the InChI of 1,3-Divinyl-1,1,3,3-tetramethyldisilazane?
The InChI is InChI=1S/C8H19NSi2/c1-7-10(3,4)9-11(5,6)8-2/h7-9H,1-2H2,3-6H3.
What is the InChIKey of 1,3-Divinyl-1,1,3,3-tetramethyldisilazane?
The InChIKey is WYUIWUCVZCRTRH-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-Divinyl-1,1,3,3-tetramethyldisilazane?
The canonical SMILES is C[Si](C)(C=C)N[Si](C)(C)C=C.
What is the CAS number of 1,3-Divinyl-1,1,3,3-tetramethyldisilazane?
The CAS number is 7691-02-3.
What is the European Community (EC) number of 1,3-Divinyl-1,1,3,3-tetramethyldisilazane?
The European Community (EC) number is 231-701-1.
What is the UNII of 1,3-Divinyl-1,1,3,3-tetramethyldisilazane?
The UNII is K53X6928T7.
Is 1,3-Divinyl-1,1,3,3-tetramethyldisilazane a canonicalized compound?
Yes, it is a canonicalized compound.