162101-25-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular weight of 3,4-Difluorophenylboronic acid is 157.91 g/mol.
The IUPAC name of 3,4-Difluorophenylboronic acid is (3,4-difluorophenyl)boronic acid.
The InChI of 3,4-Difluorophenylboronic acid is InChI=1S/C6H5BF2O2/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,10-11H.
The InChIKey of 3,4-Difluorophenylboronic acid is RMGYQBHKEWWTOY-UHFFFAOYSA-N.
The canonical SMILES of 3,4-Difluorophenylboronic acid is B(C1=CC(=C(C=C1)F)F)(O)O.
The CAS number of 3,4-Difluorophenylboronic acid is 168267-41-2.
The hydrogen bond donor count of 3,4-Difluorophenylboronic acid is 2.
The hydrogen bond acceptor count of 3,4-Difluorophenylboronic acid is 4.
The topological polar surface area of 3,4-Difluorophenylboronic acid is 40.5Ų.
Yes, 3,4-Difluorophenylboronic acid is canonically represented.