Chloromethylphenethyltris(Trimethylsiloxy)Silane

• CAS: 167426-89-3
• Catalog Number: ACM167426893
• Category: Siloxanes
• Molecular Weight: 449.28
• Molecular Formula: C₁₈H₃₇ClO₃Si₄
• Appearance: Transparent liquid

Custom Q&A

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-[4-(chloromethyl)phenyl]ethyl-tris(trimethylsilyloxy)silane.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C18H37ClO3Si4/c1-23(2,3)20-26(21-24(4,5)6,22-25(7,8)9)15-14-17-10-12-18(16-19)13-11-17/h10-13H,14-16H2,1-9H3.

What is the InChIKey of the compound?

The InChIKey of the compound is MNTJRRZVVBCLGY-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C[Si](C)(C)O[Si](CCC1=CC=C(C=C1)CCl)(O[Si](C)(C)C)O[Si](C)(C)C.

What is the molecular weight of the compound?

The molecular weight of the compound is 449.3 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 10 rotatable bond counts.

What is the exact mass of the compound?

The exact mass of the compound is 448.1508289 g/mol.

Is the compound canonicalized?

Yes, the compound is canonicalized.