[[(Chloromethyl)dimethylsilyl]methyl]trimethylsilane

• CAS: 18306-73-5
• Catalog Number: ACM18306735
• Category: Alkyl Silane
• Molecular Weight: 194.85
• Molecular Formula: C₇H₁₉ClSi₂
• IUPAC Name: chloromethyl-dimethyl-(trimethylsilylmethyl)silane
• Canonical SMILES: C[Si](C)(C)C[Si](C)(C)CCl
• InChI Key: WBZTYASEAQTKBK-UHFFFAOYSA-N
• Appearance: Transparent liquid
• EC Number: 242-193-6

Custom Q&A

What is the molecular formula of the compound in PubChem CID 87574?

The molecular formula is C7H19ClSi2.

What is the molecular weight of the compound?

The molecular weight is 194.85 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is chloromethyl-dimethyl-(trimethylsilylmethyl)silane.

What is the InChIKey of the compound?

The InChIKey is WBZTYASEAQTKBK-UHFFFAOYSA-N.

What is the topological polar surface area property value of the compound?

The topological polar surface area is 0 Ų.

How many rotatable bond counts does the compound have?

The compound has 3 rotatable bond counts.

What is the exact mass of the compound?

The exact mass is 194.0713814 g/mol.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

Is the compound canonicalized?

Yes, the compound is canonicalized.

What is the complexity property value of the compound?

The complexity property value is 105.