530141-46-9 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of the compound is C7H5ClN2.
The molecular weight of the compound is 152.58 g/mol.
The IUPAC name of the compound is 5-chloro-1H-pyrrolo[2,3-b]pyridine.
The InChI of the compound is InChI=1S/C7H5ClN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10).
The InChIKey of the compound is MFZQJIKENSPRSJ-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CNC2=NC=C(C=C21)Cl.
The CAS number of the compound is 866546-07-8.
The European Community (EC) number of the compound is 809-814-8.
The DSSTox Substance ID of the compound is DTXSID60640103.
Yes, the compound is canonicalized.