18765-09-8 Purity
96%
If you have any other questions or need other size, please get a quote.
Specification
Work good in drug synthesis
In the experiment, 4-[(4-aminophenoxy)-dimethylsilyl]oxyaniline can be used to synthesize antibacterial drugs.
C14H18N2O2Si
274.39
696-032-3
IYTXQZMZTQHONB-UHFFFAOYSA-N
C[Si](C)(OC1=CC=C(C=C1)N)OC2=CC=C(C=C2)N
Brown solid
The compound contains both an amine group (-NH2) and an aniline moiety, which make it a versatile compound for various chemical reactions. The amine group can act as a nucleophile, readily participating in reactions such as acylation, alkylation, and condensation reactions. The aniline functionality also allows for further derivatization and synthesis of other organic compounds.
This compound has limited solubility in water but is more soluble in organic solvents such as methanol, ethanol, and acetone.
4-[(4-Aminophenoxy)-Dimethylsilyl]oxyaniline can be used as a reagent or intermediate in organic synthesis. Its unique combination of functional groups makes it useful for the introduction of both amine and silane functionalities into various organic molecules.
1.149 g/cm³