CAS
2609-88-3 Purity
98%
2609-88-3 Purity
98%
Inquiry Basket
Azido-ROX
CAS
1048022-18-9
Catalog Number
ACM1048022189-1
Category
Rhodamine Fluorophores
Molecular Weight
883.96
Molecular Formula
C48H49N7O10
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C11H23N3S.
What is the molecular weight of the compound?
The molecular weight of the compound is 229.39 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 11-azidoundecane-1-thiol.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C11H23N3S/c12-14-13-10-8-6-4-2-1-3-5-7-9-11-15/h15H,1-11H2.
What is the InChIKey of the compound?
The InChIKey of the compound is YXXLZBNUURBJQC-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is C(CCCCCN=[N+]=[N-])CCCCCS.
What is the CAS number of the compound?
The CAS number of the compound is 668420-70-0.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 5.6.
How many hydrogen bond donor count does the compound have?
The compound has 1 hydrogen bond donor count.
How many rotatable bond counts does the compound have?
The compound has 11 rotatable bond counts.
Recommended Products
