5-Trifluoromethylpyridine-3-boronic acid pinacol ester

• CAS: 1084953-47-8
• Catalog Number: ACM1084953478
• Category: Boronic Esters
• Molecular Weight: 273.06
• Molecular Formula: C₁₂H₁₅BF₃NO₂
• Synonyms: 5-(Trifluoromethyl)pyridine-3-boronic acid;5-(Trifluoromethyl)pyridine-3-boronic acid pinacol ester

Custom Q&A

What is the molecular formula of 5-Trifluoromethylpyridine-3-boronic acid pinacol ester?

The molecular formula is C12H15BF3NO2.

What is the IUPAC name of 5-Trifluoromethylpyridine-3-boronic acid pinacol ester?

The IUPAC name is 3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5-(trifluoromethyl)pyridine.

What is the InChI of 5-Trifluoromethylpyridine-3-boronic acid pinacol ester?

The InChI is InChI=1S/C12H15BF3NO2/c1-10(2)11(3,4)19-13(18-10)9-5-8(6-17-7-9)12(14,15)16/h5-7H,1-4H3.

What is the InChIKey of 5-Trifluoromethylpyridine-3-boronic acid pinacol ester?

The InChIKey is LFZDWNHGQKQVIG-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Trifluoromethylpyridine-3-boronic acid pinacol ester?

The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CC(=CN=C2)C(F)(F)F.

What is the CAS number of 5-Trifluoromethylpyridine-3-boronic acid pinacol ester?

The CAS number is 1084953-47-8.

What is the molecular weight of 5-Trifluoromethylpyridine-3-boronic acid pinacol ester?

The molecular weight is 273.06 g/mol.

How many hydrogen bond donor count does 5-Trifluoromethylpyridine-3-boronic acid pinacol ester have?

It has 0 hydrogen bond donor count.

How many hydrogen bond acceptor count does 5-Trifluoromethylpyridine-3-boronic acid pinacol ester have?

It has 6 hydrogen bond acceptor count.

How many rotatable bond count does 5-Trifluoromethylpyridine-3-boronic acid pinacol ester have?

It has 1 rotatable bond count.