What is the molecular formula of 6-Carboxytetramethylrhodamine N-hydroxysuccinimide ester?
The molecular formula is C29H25N3O7.
What is the molecular weight of 6-Carboxytetramethylrhodamine N-hydroxysuccinimide ester?
The molecular weight is 527.5 g/mol.
What are some synonyms for 6-Carboxytetramethylrhodamine N-hydroxysuccinimide ester?
Some synonyms include 6-TAMRA-SE, 6-Carboxytetramethylrhodamine succinimidyl ester.
When was 6-Carboxytetramethylrhodamine N-hydroxysuccinimide ester created and last modified?
It was created on 2005-07-19 and last modified on 2023-12-30.
What is the IUPAC name for 6-Carboxytetramethylrhodamine N-hydroxysuccinimide ester?
The IUPAC name is 2-[3-(dimethylamino)-6-dimethylazaniumylidenexanthen-9-yl]-4-(2,5-dioxopyrrolidin-1-yl)oxycarbonylbenzoate.
What is the InChI key for 6-Carboxytetramethylrhodamine N-hydroxysuccinimide ester?
The InChI key is PAOQTZWNYMMSEE-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 6-Carboxytetramethylrhodamine N-hydroxysuccinimide ester?
The Canonical SMILES representation is CN(C)C1=CC2=C(C=C1)C(=C3C=CC(=[N+](C)C)C=C3O2)C4=C(C=CC(=C4)C(=O)ON5C(=O)CCC5=O)C(=O)[O-].
What is the CAS number for 6-Carboxytetramethylrhodamine N-hydroxysuccinimide ester?
The CAS number is 150810-69-8.
What is the XLogP3-AA value for 6-Carboxytetramethylrhodamine N-hydroxysuccinimide ester?
The XLogP3-AA value is 2.6.
Is the compound canonicalized for 6-Carboxytetramethylrhodamine N-hydroxysuccinimide ester?
Yes, the compound is canonicalized.