5-Methoxypyridine-3-boronic acid

• CAS: 850991-69-4
• Catalog Number: ACM850991694
• Category: Boronic Acids
• Molecular Weight: 152.94
• Molecular Formula: C₆H₈BNO₃

Custom Q&A

What is the molecular formula of 5-Methoxypyridine-3-boronic acid?

The molecular formula of 5-Methoxypyridine-3-boronic acid is C6H8BNO3.

What is the molecular weight of 5-Methoxypyridine-3-boronic acid?

The molecular weight of 5-Methoxypyridine-3-boronic acid is 152.95 g/mol.

What is the IUPAC name of 5-Methoxypyridine-3-boronic acid?

The IUPAC name of 5-Methoxypyridine-3-boronic acid is "(5-methoxypyridin-3-yl)boronic acid".

What is the InChI of 5-Methoxypyridine-3-boronic acid?

The InChI of 5-Methoxypyridine-3-boronic acid is "InChI=1S/C6H8BNO3/c1-11-6-2-5(7(9)10)3-8-4-6/h2-4,9-10H,1H3".

What is the InChIKey of 5-Methoxypyridine-3-boronic acid?

The InChIKey of 5-Methoxypyridine-3-boronic acid is "ISDFOFZTZUILPE-UHFFFAOYSA-N".

What is the canonical SMILES of 5-Methoxypyridine-3-boronic acid?

The canonical SMILES of 5-Methoxypyridine-3-boronic acid is "B(C1=CC(=CN=C1)OC)(O)O".

What is the CAS number of 5-Methoxypyridine-3-boronic acid?

The CAS number of 5-Methoxypyridine-3-boronic acid is 850991-69-4.

What is the hydrogen bond donor count of 5-Methoxypyridine-3-boronic acid?

The hydrogen bond donor count of 5-Methoxypyridine-3-boronic acid is 2.

What is the hydrogen bond acceptor count of 5-Methoxypyridine-3-boronic acid?

The hydrogen bond acceptor count of 5-Methoxypyridine-3-boronic acid is 4.

How many rotatable bonds does 5-Methoxypyridine-3-boronic acid have?

5-Methoxypyridine-3-boronic acid has 2 rotatable bonds.