5-Methoxycarbonyl-2-methylphenylboronic acid pinacol ester

• CAS: 882679-40-5
• Catalog Number: ACM882679405
• Category: Other
• Molecular Formula: C₁₅H₂₁BO₄

Custom Q&A

What is the molecular formula of 5-Methoxycarbonyl-2-methylphenylboronic acid pinacol ester?

The molecular formula is C15H21BO4.

What is the molecular weight of 5-Methoxycarbonyl-2-methylphenylboronic acid pinacol ester?

The molecular weight is 276.14 g/mol.

What is the IUPAC name of 5-Methoxycarbonyl-2-methylphenylboronic acid pinacol ester?

The IUPAC name is methyl 4-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoate.

What is the InChI of 5-Methoxycarbonyl-2-methylphenylboronic acid pinacol ester?

The InChI is InChI=1S/C15H21BO4/c1-10-7-8-11(13(17)18-6)9-12(10)16-19-14(2,3)15(4,5)20-16/h7-9H,1-6H3.

What is the InChIKey of 5-Methoxycarbonyl-2-methylphenylboronic acid pinacol ester?

The InChIKey is HAPIXNBOBZHNCA-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Methoxycarbonyl-2-methylphenylboronic acid pinacol ester?

The canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2)C(=O)OC).

What is the CAS number of 5-Methoxycarbonyl-2-methylphenylboronic acid pinacol ester?

The CAS number is 882679-40-5.

What is the European Community (EC) number of 5-Methoxycarbonyl-2-methylphenylboronic acid pinacol ester?

The EC number is 690-925-1.

What is the DSSTox Substance ID of 5-Methoxycarbonyl-2-methylphenylboronic acid pinacol ester?

The DSSTox Substance ID is DTXSID90682238.

Is 5-Methoxycarbonyl-2-methylphenylboronic acid pinacol ester a canonicalized compound?

Yes, it is a canonicalized compound.