677777-45-6 Purity
96%
If you have any other questions or need other size, please get a quote.
A good liquid crystal material.
5-Cyano-2-methylphenylboronic acid shows good stability and can be used as a liquid crystal display material.
The IUPAC name of the compound is (5-cyano-2-methylphenyl)boronic acid.
The molecular formula of the compound is C8H8BNO2.
The molecular weight of the compound is 160.97 g/mol.
The InChI of the compound is InChI=1S/C8H8BNO2/c1-6-2-3-7(5-10)4-8(6)9(11)12/h2-4,11-12H,1H3.
The InChIKey of the compound is IPDZHWUWADJUMR-UHFFFAOYSA-N.
The canonical SMILES of the compound is B(C1=C(C=CC(=C1)C#N)C)(O)O.
The CAS number of the compound is 867333-43-5.
The European Community (EC) Number of the compound is 801-760-3.
The compound has 2 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.