5-Carboxy-2-fluorophenylboronic acid

• CAS: 874219-59-7
• Catalog Number: ACM874219597
• Category: Boronic Acids
• Molecular Weight: 183.93
• Molecular Formula: C₇H₆O₄BF

Custom Q&A

What is the molecular formula of 5-Carboxy-2-fluorophenylboronic acid?

The molecular formula of 5-Carboxy-2-fluorophenylboronic acid is C7H6BFO4.

How is the molecular weight of 5-Carboxy-2-fluorophenylboronic acid calculated?

The molecular weight of 5-Carboxy-2-fluorophenylboronic acid is computed to be 183.93 g/mol.

What is the IUPAC name of 5-Carboxy-2-fluorophenylboronic acid?

The IUPAC name of 5-Carboxy-2-fluorophenylboronic acid is 3-borono-4-fluorobenzoic acid.

What is the InChI of 5-Carboxy-2-fluorophenylboronic acid?

The InChI of 5-Carboxy-2-fluorophenylboronic acid is "InChI=1S/C7H6BFO4/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,12-13H,(H,10,11)".

What is the InChIKey of 5-Carboxy-2-fluorophenylboronic acid?

The InChIKey of 5-Carboxy-2-fluorophenylboronic acid is "YLZPFWJYAFZZHF-UHFFFAOYSA-N".

What is the canonical SMILES of 5-Carboxy-2-fluorophenylboronic acid?

The canonical SMILES of 5-Carboxy-2-fluorophenylboronic acid is "B(C1=C(C=CC(=C1)C(=O)O)F)(O)O".

What is the CAS number of 5-Carboxy-2-fluorophenylboronic acid?

The CAS number of 5-Carboxy-2-fluorophenylboronic acid is 874219-59-7.

What is the European Community (EC) number of 5-Carboxy-2-fluorophenylboronic acid?

The European Community (EC) number of 5-Carboxy-2-fluorophenylboronic acid is 690-780-4.

What is the DSSTox Substance ID of 5-Carboxy-2-fluorophenylboronic acid?

The DSSTox Substance ID of 5-Carboxy-2-fluorophenylboronic acid is DTXSID20619072.

Is 5-Carboxy-2-fluorophenylboronic acid a canonical compound?

Yes, 5-Carboxy-2-fluorophenylboronic acid is a canonical compound.