5-Bromo-4-chloro-2-fluorobenzoic acid

• CAS: 289038-22-8
• Catalog Number: ACM289038228
• Category: Bromine Series
• Molecular Weight: 253.45
• Molecular Formula: C₇H₃BrClFO₂

Custom Q&A

What is the molecular formula of 5-Bromo-4-chloro-2-fluorobenzoic acid?

The molecular formula of 5-Bromo-4-chloro-2-fluorobenzoic acid is C7H3BrClFO2.

What is the molecular weight of 5-Bromo-4-chloro-2-fluorobenzoic acid?

The molecular weight of 5-Bromo-4-chloro-2-fluorobenzoic acid is 253.45 g/mol.

What is the IUPAC name of 5-Bromo-4-chloro-2-fluorobenzoic acid?

The IUPAC name of 5-Bromo-4-chloro-2-fluorobenzoic acid is 5-bromo-4-chloro-2-fluorobenzoic acid.

What is the InChI of 5-Bromo-4-chloro-2-fluorobenzoic acid?

The InChI of 5-Bromo-4-chloro-2-fluorobenzoic acid is InChI=1S/C7H3BrClFO2/c8-4-1-3(7(11)12)6(10)2-5(4)9/h1-2H,(H,11,12).

What is the InChIKey of 5-Bromo-4-chloro-2-fluorobenzoic acid?

The InChIKey of 5-Bromo-4-chloro-2-fluorobenzoic acid is GJVIVXZNTOVQRG-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Bromo-4-chloro-2-fluorobenzoic acid?

The canonical SMILES of 5-Bromo-4-chloro-2-fluorobenzoic acid is C1=C(C(=CC(=C1Br)Cl)F)C(=O)O.

What is the CAS number of 5-Bromo-4-chloro-2-fluorobenzoic acid?

The CAS number of 5-Bromo-4-chloro-2-fluorobenzoic acid is 289038-22-8.

What is the XLogP3-AA value of 5-Bromo-4-chloro-2-fluorobenzoic acid?

The XLogP3-AA value of 5-Bromo-4-chloro-2-fluorobenzoic acid is 2.9.

How many hydrogen bond donor atoms are there in 5-Bromo-4-chloro-2-fluorobenzoic acid?

There is 1 hydrogen bond donor atom in 5-Bromo-4-chloro-2-fluorobenzoic acid.

How many hydrogen bond acceptor atoms are there in 5-Bromo-4-chloro-2-fluorobenzoic acid?

There are 3 hydrogen bond acceptor atoms in 5-Bromo-4-chloro-2-fluorobenzoic acid.