5-Bromo-3-chloro-2-methoxypyridine

• CAS: 848366-28-9
• Catalog Number: ACM848366289
• Category: Bromine Series
• Molecular Weight: 222.47
• Molecular Formula: C₆H₅BrClNO

Custom Q&A

What is the PubChem CID of 5-Bromo-3-chloro-2-methoxypyridine?

PubChem CID of 5-Bromo-3-chloro-2-methoxypyridine is 40427004.

What is the molecular formula of 5-Bromo-3-chloro-2-methoxypyridine?

The molecular formula of 5-Bromo-3-chloro-2-methoxypyridine is C6H5BrClNO.

What is the molecular weight of 5-Bromo-3-chloro-2-methoxypyridine?

The molecular weight of 5-Bromo-3-chloro-2-methoxypyridine is 222.47 g/mol.

What is the IUPAC name of 5-Bromo-3-chloro-2-methoxypyridine?

The IUPAC name of 5-Bromo-3-chloro-2-methoxypyridine is 5-bromo-3-chloro-2-methoxypyridine.

What is the InChI of 5-Bromo-3-chloro-2-methoxypyridine?

The InChI of 5-Bromo-3-chloro-2-methoxypyridine is InChI=1S/C6H5BrClNO/c1-10-6-5(8)2-4(7)3-9-6/h2-3H,1H3.

What is the InChIKey of 5-Bromo-3-chloro-2-methoxypyridine?

The InChIKey of 5-Bromo-3-chloro-2-methoxypyridine is XCHXNAQRMMXBGN-UHFFFAOYSA-N.

What is the canonical SMILES of 5-Bromo-3-chloro-2-methoxypyridine?

The canonical SMILES of 5-Bromo-3-chloro-2-methoxypyridine is COC1=C(C=C(C=N1)Br)Cl.

What is the CAS number of 5-Bromo-3-chloro-2-methoxypyridine?

The CAS number of 5-Bromo-3-chloro-2-methoxypyridine is 848366-28-9.

What is the EC number of 5-Bromo-3-chloro-2-methoxypyridine?

The EC number of 5-Bromo-3-chloro-2-methoxypyridine is 695-756-7.

Is 5-Bromo-3-chloro-2-methoxypyridine a canonicalized compound?

Yes, 5-Bromo-3-chloro-2-methoxypyridine is a canonicalized compound.