5-Bromo-2-methylpyridin-3-amine

• CAS: 914358-73-9
• Catalog Number: ACM914358739
• Category: Bromine Series
• Molecular Weight: 187.03
• Molecular Formula: C₆H₇BrN₂

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C6H7BrN2.

What is the molecular weight of the compound?

The molecular weight of the compound is 187.04 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 5-bromo-2-methylpyridin-3-amine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H7BrN2/c1-4-6(8)2-5(7)3-9-4/h2-3H,8H2,1H3.

What is the InChIKey of the compound?

The InChIKey of the compound is CBAXYISWNGGXOZ-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1=C(C=C(C=N1)Br)N.

What is the CAS number of the compound?

The CAS number of the compound is 914358-73-9.

What is the ChEMBL ID of the compound?

The ChEMBL ID of the compound is CHEMBL4563616.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value of the compound is 1.3.

Is the compound canonicalized?

Yes, the compound is canonicalized.