5-Bromo-2-hydroxy-3-nitro-4-picoline

• CAS: 228410-90-0
• Catalog Number: ACM228410900
• Category: Bromine Series
• Molecular Weight: 233.02
• Molecular Formula: C₆H₅BrN₂O₃

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C6H5BrN2O3.

What is the molecular weight of the compound?

The molecular weight of the compound is 233.02 g/mol.

When was the compound created?

The compound was created on December 5, 2007.

When was the compound last modified?

The compound was last modified on December 2, 2023.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 5-bromo-4-methyl-3-nitro-1H-pyridin-2-one.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C6H5BrN2O3/c1-3-4(7)2-8-6(10)5(3)9(11)12/h2H,1H3,(H,8,10).

What is the InChIKey of the compound?

The InChIKey of the compound is QXPNHVCGSASGIX-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CC1=C(C(=O)NC=C1Br)[N+](=O)[O-].

What is the CAS number of the compound?

The CAS number of the compound is 228410-90-0.

What is the Monoisotopic Mass of the compound?

The Monoisotopic Mass of the compound is 231.94835 g/mol.