5-bromo-2-chloro-4-methyl-3-nitropyridine

• CAS: 884495-15-2
• Catalog Number: ACM884495152
• Category: Bromine Series
• Molecular Weight: 251.46
• Molecular Formula: C₆H₄N₂O₂BrCl

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C6H4BrClN2O2.

What is the molecular weight of the compound?

The molecular weight is 251.46 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 5-bromo-2-chloro-4-methyl-3-nitropyridine.

What is the InChI key of the compound?

The InChI key is BLJOCKNDWUTFEN-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is CC1=C(C(=NC=C1Br)Cl)[N+](=O)[O-].

What is the CAS number of the compound?

The CAS number is 884495-15-2.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 2.7.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 0 rotatable bond counts.