CAS
29558-77-8 Purity
98%+
29558-77-8 Purity
98%+
Inquiry Basket
5-Bromo-1-mehtyl-1H-indazole
CAS
465529-57-1
Catalog Number
ACM465529571
Category
Bromine Series
Molecular Weight
211.06
Molecular Formula
C8H7BrN2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of the compound?
The molecular formula of the compound is C8H7BrN2.
What is the molecular weight of the compound?
The molecular weight of the compound is 211.06 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 5-bromo-1-methylindazole.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C8H7BrN2/c1-11-8-3-2-7(9)4-6(8)5-10-11/h2-5H,1H3.
What is the InChIKey of the compound?
The InChIKey of the compound is RMCHMXPTUMFFBZ-UHFFFAOYSA-N.
What is the CAS number of the compound?
The CAS number of the compound is 465529-57-1.
What is the European Community (EC) number of the compound?
The European Community (EC) number of the compound is 687-926-4.
What is the DSSTox Substance ID of the compound?
The DSSTox Substance ID of the compound is DTXSID00626441.
What is the XLogP3-AA value of the compound?
The XLogP3-AA value of the compound is 2.3.
Is the compound canonicalized?
Yes, the compound is canonicalized.
Recommended Products
