CAS
1035235-26-7 Purity
---
1035235-26-7 Purity
---
Inquiry Basket
4-(Methoxycarbonyl)-2-methylphenylboronic acid
CAS
158429-38-0
Catalog Number
ACM158429380
Category
Other Products; Boronic Acids
Molecular Formula
C9H11BO4
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
May 23, 2023
High activity catalyst.
4-(Methoxycarbonyl)-2-methylphenylboronic acid can effectively catalyze the homogeneous aromatic substitution reaction.
What is the molecular formula of the compound?
The molecular formula of the compound is C9H11BO4.
What are the synonyms of the compound?
The synonyms of the compound are 158429-38-0, (4-(Methoxycarbonyl)-2-methylphenyl)boronic acid, 4-(METHOXYCARBONYL)-2-METHYLPHENYLBORONIC ACID, and [4-(methoxycarbonyl)-2-methylphenyl]boronic acid.
What is the molecular weight of the compound?
The molecular weight of the compound is 193.99 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is (4-methoxycarbonyl-2-methylphenyl)boronic acid.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C9H11BO4/c1-6-5-7(9(11)14-2)3-4-8(6)10(12)13/h3-5,12-13H,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is MOBGLFACQCDFEQ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is B(C1=C(C=C(C=C1)C(=O)OC)C)(O)O.
What is the CAS number of the compound?
The CAS number of the compound is 158429-38-0.
What is the hydrogen bond donor count of the compound?
The compound has 2 hydrogen bond donor counts.
What is the hydrogen bond acceptor count of the compound?
The compound has 4 hydrogen bond acceptor counts.
Recommended Products
