636-25-9 Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 4-Hydroxyisophthalic acid is C8H6O5.
The molecular weight of 4-Hydroxyisophthalic acid is 182.13 g/mol.
Some synonyms for 4-Hydroxyisophthalic acid are Eupirina and 4-Hydroxybenzene-1,3-dicarboxylic acid.
The IUPAC name of 4-Hydroxyisophthalic acid is 4-hydroxybenzene-1,3-dicarboxylic acid.
The InChIKey of 4-Hydroxyisophthalic acid is BCEQKAQCUWUNML-UHFFFAOYSA-N.
The Canonical SMILES representation of 4-Hydroxyisophthalic acid is C1=CC(=C(C=C1C(=O)O)C(=O)O)O.
The CAS number for 4-Hydroxyisophthalic acid is 636-46-4.
The XLogP3 value of 4-Hydroxyisophthalic acid is 1.5.
The hydrogen bond donor count of 4-Hydroxyisophthalic acid is 3.
Yes, 4-Hydroxyisophthalic acid is a canonicalized compound.