What is the molecular formula of (4-(Chloromethyl)phenethyl)dimethoxy(methyl)silane?
The molecular formula is C12H19ClO2Si.
What is the molecular weight of (4-(Chloromethyl)phenethyl)dimethoxy(methyl)silane?
The molecular weight is 258.81 g/mol.
What is the IUPAC name of (4-(Chloromethyl)phenethyl)dimethoxy(methyl)silane?
The IUPAC name is 2-[4-(chloromethyl)phenyl]ethyl-dimethoxy-methylsilane.
What is the InChI of (4-(Chloromethyl)phenethyl)dimethoxy(methyl)silane?
The InChI is InChI=1S/C12H19ClO2Si/c1-14-16(3,15-2)9-8-11-4-6-12(10-13)7-5-11/h4-7H,8-10H2,1-3H3.
What is the InChIKey of (4-(Chloromethyl)phenethyl)dimethoxy(methyl)silane?
The InChIKey is XTAQZMSEXOKVCH-UHFFFAOYSA-N.
What is the canonical SMILES of (4-(Chloromethyl)phenethyl)dimethoxy(methyl)silane?
The canonical SMILES is CO[Si](C)(CCC1=CC=C(C=C1)CCl)OC.
How many hydrogen bond donor counts are there in (4-(Chloromethyl)phenethyl)dimethoxy(methyl)silane?
There are 0 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in (4-(Chloromethyl)phenethyl)dimethoxy(methyl)silane?
There are 2 hydrogen bond acceptor counts.
How many rotatable bond counts are there in (4-(Chloromethyl)phenethyl)dimethoxy(methyl)silane?
There are 6 rotatable bond counts.
Is (4-(Chloromethyl)phenethyl)dimethoxy(methyl)silane a canonicalized compound?
Yes, it is a canonicalized compound.