4-(Bromomethyl)-biphenyl

• CAS: 2567-29-5
• Catalog Number: ACM2567295
• Category: Bromine Series
• Molecular Weight: 247.13
• Molecular Formula: C₁₃H₁₁Br

Custom Q&A

What is the molecular formula of 4-(Bromomethyl)-biphenyl?

The molecular formula is C13H11Br.

What is the molecular weight of 4-(Bromomethyl)-biphenyl?

The molecular weight is 247.13 g/mol.

What is the IUPAC name of 4-(Bromomethyl)-biphenyl?

The IUPAC name is 1-(bromomethyl)-4-phenylbenzene.

What is the InChI of 4-(Bromomethyl)-biphenyl?

The InChI is InChI=1S/C13H11Br/c14-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2.

What is the InChIKey of 4-(Bromomethyl)-biphenyl?

The InChIKey is HZQLUIZFUXNFHK-UHFFFAOYSA-N.

What is the Canonical SMILES of 4-(Bromomethyl)-biphenyl?

The Canonical SMILES is C1=CC=C(C=C1)C2=CC=C(C=C2)CBr.

What is the CAS number of 4-(Bromomethyl)-biphenyl?

The CAS number is 2567-29-5.

What is the European Community (EC) number of 4-(Bromomethyl)-biphenyl?

The European Community (EC) number is 663-894-7.

What is the DSSTox Substance ID of 4-(Bromomethyl)-biphenyl?

The DSSTox Substance ID is DTXSID40292866.

Is 4-(Bromomethyl)-biphenyl considered a canonicalized compound?

Yes, 4-(Bromomethyl)-biphenyl is a canonicalized compound.