4-Bromo-2,3-difluoroanisole

• CAS: 406482-22-2
• Catalog Number: ACM406482222
• Category: Bromine Series
• Molecular Weight: 223.0148
• Molecular Formula: C₇H₅BrF₂O

Custom Q&A

What is the molecular formula of 4-Bromo-2,3-difluoroanisole?

The molecular formula of 4-Bromo-2,3-difluoroanisole is C7H5BrF2O.

What is the molecular weight of 4-Bromo-2,3-difluoroanisole?

The molecular weight of 4-Bromo-2,3-difluoroanisole is 223.01 g/mol.

What are the synonyms of 4-Bromo-2,3-difluoroanisole?

The synonyms of 4-Bromo-2,3-difluoroanisole include 406482-22-2, 1-bromo-2,3-difluoro-4-methoxybenzene, and 2,3-DIFLUORO-4-BROMOANISOLE.

What is the CAS number of 4-Bromo-2,3-difluoroanisole?

The CAS number of 4-Bromo-2,3-difluoroanisole is 406482-22-2.

What is the InChI of 4-Bromo-2,3-difluoroanisole?

The InChI of 4-Bromo-2,3-difluoroanisole is InChI=1S/C7H5BrF2O/c1-11-5-3-2-4(8)6(9)7(5)10/h2-3H,1H3.

What is the InChIKey of 4-Bromo-2,3-difluoroanisole?

The InChIKey of 4-Bromo-2,3-difluoroanisole is VZMFIPVRFWZDPI-UHFFFAOYSA-N.

What is the XLogP3-AA value of 4-Bromo-2,3-difluoroanisole?

The XLogP3-AA value of 4-Bromo-2,3-difluoroanisole is 2.8.

How many hydrogen bond donor counts does 4-Bromo-2,3-difluoroanisole have?

4-Bromo-2,3-difluoroanisole has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4-Bromo-2,3-difluoroanisole have?

4-Bromo-2,3-difluoroanisole has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does 4-Bromo-2,3-difluoroanisole have?

4-Bromo-2,3-difluoroanisole has 1 rotatable bond count.