4,4-(Dimethylcyclohexene-1-yl)boronic acid, pinacol ester

• CAS: 859217-67-7
• Catalog Number: ACM859217677-1
• Category: Boronic Esters

Custom Q&A

What is the molecular formula of 4,4-(Dimethylcyclohexene-1-yl)boronic acid, pinacol ester?

The molecular formula is C14H25BO2.

What is the IUPAC name of 4,4-(Dimethylcyclohexene-1-yl)boronic acid, pinacol ester?

The IUPAC name is 2-(4,4-dimethylcyclohexen-1-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.

What is the InChI key of 4,4-(Dimethylcyclohexene-1-yl)boronic acid, pinacol ester?

The InChI key is JQEUELMRQYUNDS-UHFFFAOYSA-N.

How is the Canonical SMILES of 4,4-(Dimethylcyclohexene-1-yl)boronic acid, pinacol ester represented?

The Canonical SMILES is B1(OC(C(O1)(C)C)(C)C)C2=CCC(CC2)(C)C.

What is the molecular weight of 4,4-(Dimethylcyclohexene-1-yl)boronic acid, pinacol ester?

The molecular weight is 236.16 g/mol.

How many hydrogen bond donor counts does 4,4-(Dimethylcyclohexene-1-yl)boronic acid, pinacol ester have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 4,4-(Dimethylcyclohexene-1-yl)boronic acid, pinacol ester have?

It has 2 hydrogen bond acceptor counts.

What is the topological polar surface area of 4,4-(Dimethylcyclohexene-1-yl)boronic acid, pinacol ester?

The topological polar surface area is 18.5 Ų.

How many heavy atoms are present in 4,4-(Dimethylcyclohexene-1-yl)boronic acid, pinacol ester?

There are 17 heavy atoms.

Is 4,4-(Dimethylcyclohexene-1-yl)boronic acid, pinacol ester a canonicalized compound?

Yes, it is a canonicalized compound.