4-(4-Bromobenzyl)morpholine

• CAS: 132833-51-3
• Catalog Number: ACM132833513
• Category: Other
• Molecular Formula: C₁₁H₁₄BrNO

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C11H14BrNO.

What is the molecular weight of the compound?

The molecular weight of the compound is 256.14 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-[(4-bromophenyl)methyl]morpholine.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H14BrNO/c12-11-3-1-10(2-4-11)9-13-5-7-14-8-6-13/h1-4H,5-9H2.

What is the InChIKey of the compound?

The InChIKey of the compound is KWJZFQQTDGVBOX-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is C1COCCN1CC2=CC=C(C=C2)Br.

What is the CAS number of the compound?

The CAS number of the compound is 132833-51-3.

What is the EC number of the compound?

The EC number of the compound is 808-403-0.

What is the XLogP3 value of the compound?

The XLogP3 value of the compound is 2.3.

Is the compound canonicalized?

Yes, the compound is canonicalized.