3-Trimethylsilylpropargylmethacrylate

• CAS: 214268-06-1
• Catalog Number: ACM214268061
• Category: Siloxanes
• Molecular Weight: 195.31
• Molecular Formula: C₁₀H₁₅O₂Si
• Appearance: Transparent liquid

Custom Q&A

What is the molecular formula of 3-Trimethylsilylpropargylmethacrylate?

The molecular formula of 3-Trimethylsilylpropargylmethacrylate is C10H16O2Si.

What is the molecular weight of 3-Trimethylsilylpropargylmethacrylate?

The molecular weight of 3-Trimethylsilylpropargylmethacrylate is 196.32 g/mol.

What is the IUPAC name of 3-Trimethylsilylpropargylmethacrylate?

The IUPAC name of 3-Trimethylsilylpropargylmethacrylate is 3-trimethylsilylprop-2-ynyl 2-methylprop-2-enoate.

What is the InChI of 3-Trimethylsilylpropargylmethacrylate?

The InChI of 3-Trimethylsilylpropargylmethacrylate is InChI=1S/C10H16O2Si/c1-9(2)10(11)12-7-6-8-13(3,4)5/h1,7H2,2-5H3.

What is the InChIKey of 3-Trimethylsilylpropargylmethacrylate?

The InChIKey of 3-Trimethylsilylpropargylmethacrylate is ZFHCOMDLFYIXAG-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Trimethylsilylpropargylmethacrylate?

The canonical SMILES of 3-Trimethylsilylpropargylmethacrylate is CC(=C)C(=O)OCC#C[Si](C)(C)C.

What is the hydrogen bond donor count of 3-Trimethylsilylpropargylmethacrylate?

The hydrogen bond donor count of 3-Trimethylsilylpropargylmethacrylate is 0.

What is the hydrogen bond acceptor count of 3-Trimethylsilylpropargylmethacrylate?

The hydrogen bond acceptor count of 3-Trimethylsilylpropargylmethacrylate is 2.

What is the rotatable bond count of 3-Trimethylsilylpropargylmethacrylate?

The rotatable bond count of 3-Trimethylsilylpropargylmethacrylate is 4.

Is 3-Trimethylsilylpropargylmethacrylate a canonicalized compound?

Yes, 3-Trimethylsilylpropargylmethacrylate is a canonicalized compound.