3-Phenylglutaric acid

• CAS: 4165-96-2
• Catalog Number: ACM4165962
• Category: Polymer/Macromolecule
• Molecular Weight: 208.21
• Molecular Formula: C₁₁H₁₂O₄
• Synonyms: 3-PHENYLGLUTARIC ACID;3-Phenylglutaric acid, 98+%;3-Phenylglutaricacid,97%;Benzylsuccinic;Pentanedioic acid, 3-phenyl-;3-Phenylpentanedioic acid

Custom Q&A

What is the molecular formula of 3-Phenylglutaric acid?

The molecular formula of 3-Phenylglutaric acid is C11H12O4.

What is the molecular weight of 3-Phenylglutaric acid?

The molecular weight of 3-Phenylglutaric acid is 208.21 g/mol.

What is the IUPAC name of 3-Phenylglutaric acid?

The IUPAC name of 3-Phenylglutaric acid is 3-phenylpentanedioic acid.

What is the InChI of 3-Phenylglutaric acid?

The InChI of 3-Phenylglutaric acid is InChI=1S/C11H12O4/c12-10(13)6-9(7-11(14)15)8-4-2-1-3-5-8/h1-5,9H,6-7H2,(H,12,13)(H,14,15).

What is the InChIKey of 3-Phenylglutaric acid?

The InChIKey of 3-Phenylglutaric acid is RZOKZOYSUCSPDF-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Phenylglutaric acid?

The canonical SMILES of 3-Phenylglutaric acid is C1=CC=C(C=C1)C(CC(=O)O)CC(=O)O.

What is the CAS number of 3-Phenylglutaric acid?

The CAS number of 3-Phenylglutaric acid is 4165-96-2.

What is the XLogP3 value of 3-Phenylglutaric acid?

The XLogP3 value of 3-Phenylglutaric acid is 1.1.

How many hydrogen bond donor counts does 3-Phenylglutaric acid have?

3-Phenylglutaric acid has 2 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Phenylglutaric acid have?

3-Phenylglutaric acid has 4 hydrogen bond acceptor counts.