3-Methoxymethylphenylboronic acid

• CAS: 142273-84-5
• Catalog Number: ACM142273845
• Category: Boronic Acids
• Molecular Weight: 165.98
• Molecular Formula: C₈H₁₁BO₃

Custom Q&A

What is the molecular formula of 3-Methoxymethylphenylboronic acid?

The molecular formula of 3-Methoxymethylphenylboronic acid is C8H11BO3.

What is the molecular weight of 3-Methoxymethylphenylboronic acid?

The molecular weight of 3-Methoxymethylphenylboronic acid is 165.98 g/mol.

What is the IUPAC name of 3-Methoxymethylphenylboronic acid?

The IUPAC name of 3-Methoxymethylphenylboronic acid is [3-(methoxymethyl)phenyl]boronic acid.

What is the InChI of 3-Methoxymethylphenylboronic acid?

The InChI of 3-Methoxymethylphenylboronic acid is InChI=1S/C8H11BO3/c1-12-6-7-3-2-4-8(5-7)9(10)11/h2-5,10-11H,6H2,1H3.

What is the InChIkey of 3-Methoxymethylphenylboronic acid?

The InChIkey of 3-Methoxymethylphenylboronic acid is XOSGESMDNPVZKS-UHFFFAOYSA-N.

How many hydrogen bond donor counts are in 3-Methoxymethylphenylboronic acid?

There are 2 hydrogen bond donor counts in 3-Methoxymethylphenylboronic acid.

How many hydrogen bond acceptor counts are in 3-Methoxymethylphenylboronic acid?

There are 3 hydrogen bond acceptor counts in 3-Methoxymethylphenylboronic acid.

What is the topological polar surface area of 3-Methoxymethylphenylboronic acid?

The topological polar surface area of 3-Methoxymethylphenylboronic acid is 49.7Ų.

How many rotatable bond counts are in 3-Methoxymethylphenylboronic acid?

There are 3 rotatable bond counts in 3-Methoxymethylphenylboronic acid.

Is 3-Methoxymethylphenylboronic acid defined as canonicalized?

Yes, 3-Methoxymethylphenylboronic acid is defined as canonicalized.