3-Methoxy-4-methylphenylboronic acid

• CAS: 917757-15-4
• Catalog Number: ACM917757154
• Category: Boronic Acids
• Molecular Weight: 165.98
• Molecular Formula: C₈H₁₁BO₃
• Synonyms: 3-Methoxy-4-methylbenzeneboronic acid, 97%

Custom Q&A

What is the molecular formula of 3-Methoxy-4-methylphenylboronic acid?

The molecular formula of 3-Methoxy-4-methylphenylboronic acid is C8H11BO3.

What is the molecular weight of 3-Methoxy-4-methylphenylboronic acid?

The molecular weight of 3-Methoxy-4-methylphenylboronic acid is 165.98 g/mol.

What is the IUPAC name of 3-Methoxy-4-methylphenylboronic acid?

The IUPAC name of 3-Methoxy-4-methylphenylboronic acid is (3-methoxy-4-methylphenyl)boronic acid.

What is the InChI of 3-Methoxy-4-methylphenylboronic acid?

The InChI of 3-Methoxy-4-methylphenylboronic acid is InChI=1S/C8H11BO3/c1-6-3-4-7(9(10)11)5-8(6)12-2/h3-5,10-11H,1-2H3.

What is the InChIKey of 3-Methoxy-4-methylphenylboronic acid?

The InChIKey of 3-Methoxy-4-methylphenylboronic acid is UMGAGEBOUIODFE-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Methoxy-4-methylphenylboronic acid?

The canonical SMILES of 3-Methoxy-4-methylphenylboronic acid is B(C1=CC(=C(C=C1)C)OC)(O)O.

What is the CAS number of 3-Methoxy-4-methylphenylboronic acid?

The CAS number of 3-Methoxy-4-methylphenylboronic acid is 917757-15-4.

What is the hydrogen bond donor count of 3-Methoxy-4-methylphenylboronic acid?

The hydrogen bond donor count of 3-Methoxy-4-methylphenylboronic acid is 2.

What is the hydrogen bond acceptor count of 3-Methoxy-4-methylphenylboronic acid?

The hydrogen bond acceptor count of 3-Methoxy-4-methylphenylboronic acid is 3.

Is 3-Methoxy-4-methylphenylboronic acid a canonicalized compound?

Yes, 3-Methoxy-4-methylphenylboronic acid is a canonicalized compound.