3-Isocyanatopropylmethyldiethoxysilane

• CAS: 33491-28-0
• Catalog Number: ACM33491280
• Category: Siloxanes
• Molecular Weight: 203.31
• Molecular Formula: C₈H₁₇NO₃Si
• Appearance: Transparent liquid

Custom Q&A

What is the molecular formula of 3-Isocyanatopropylmethyldiethoxysilane?

The molecular formula of 3-Isocyanatopropylmethyldiethoxysilane is C8H16NO3Si.

What is the molecular weight of 3-Isocyanatopropylmethyldiethoxysilane?

The molecular weight of 3-Isocyanatopropylmethyldiethoxysilane is 202.30 g/mol.

What is the InChI of 3-Isocyanatopropylmethyldiethoxysilane?

The InChI of 3-Isocyanatopropylmethyldiethoxysilane is InChI=1S/C8H16NO3Si/c1-3-11-13(12-4-2)7-5-6-9-8-10/h3-7H2,1-2H3.

What is the InChIKey of 3-Isocyanatopropylmethyldiethoxysilane?

The InChIKey of 3-Isocyanatopropylmethyldiethoxysilane is JJANCSRXIRTCQZ-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Isocyanatopropylmethyldiethoxysilane?

The canonical SMILES of 3-Isocyanatopropylmethyldiethoxysilane is CCO[Si](CCCN=C=O)OCC.

How many hydrogen bond donor counts are there in 3-Isocyanatopropylmethyldiethoxysilane?

There are 0 hydrogen bond donor counts in 3-Isocyanatopropylmethyldiethoxysilane.

How many hydrogen bond acceptor counts are there in 3-Isocyanatopropylmethyldiethoxysilane?

There are 4 hydrogen bond acceptor counts in 3-Isocyanatopropylmethyldiethoxysilane.

How many rotatable bond counts are there in 3-Isocyanatopropylmethyldiethoxysilane?

There are 8 rotatable bond counts in 3-Isocyanatopropylmethyldiethoxysilane.

What is the exact mass of 3-Isocyanatopropylmethyldiethoxysilane?

The exact mass of 3-Isocyanatopropylmethyldiethoxysilane is 202.08994491 g/mol.

Is 3-Isocyanatopropylmethyldiethoxysilane canonicalized?

Yes, 3-Isocyanatopropylmethyldiethoxysilane is canonicalized.