3-Fluoro-5-(hydroxymethyl)phenylboronic acid

• CAS: 1146614-40-5
• Catalog Number: ACM1146614405
• Category: Boronic Acids

Custom Q&A

What is the molecular formula of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid?

The molecular formula of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid is C7H8BFO3.

What is the molecular weight of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid?

The molecular weight of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid is 169.95 g/mol.

What is the IUPAC name of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid?

The IUPAC name of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid is [3-fluoro-5-(hydroxymethyl)phenyl]boronic acid.

What is the InChI of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid?

The InChI of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid is InChI=1S/C7H8BFO3/c9-7-2-5(4-10)1-6(3-7)8(11)12/h1-3,10-12H,4H2.

What is the InChIKey of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid?

The InChIKey of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid is BLNFWNSYUVQREC-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid?

The canonical SMILES of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid is B(C1=CC(=CC(=C1)F)CO)(O)O.

What is the CAS number of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid?

The CAS number of 3-Fluoro-5-(hydroxymethyl)phenylboronic acid is 1146614-40-5.

How many hydrogen bond donor counts does 3-Fluoro-5-(hydroxymethyl)phenylboronic acid have?

3-Fluoro-5-(hydroxymethyl)phenylboronic acid has 3 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Fluoro-5-(hydroxymethyl)phenylboronic acid have?

3-Fluoro-5-(hydroxymethyl)phenylboronic acid has 4 hydrogen bond acceptor counts.

How many rotatable bond counts does 3-Fluoro-5-(hydroxymethyl)phenylboronic acid have?

3-Fluoro-5-(hydroxymethyl)phenylboronic acid has 2 rotatable bond counts.