3-Chloro-4-methoxybenzenemethanamine

• CAS: 115514-77-7
• Catalog Number: ACM115514777
• Category: Other Products
• Molecular Weight: 171.62
• Molecular Formula: C₈H₁₀ClNO
• Synonyms: 3-chloro-4-methoxybenzenemethanamine;BenzeneMethanaMine, 3-chloro-4-Methoxy-;3-Chloro-4-methoxybenzenemethanamine###3-Chloro-4-methoxybenzyl alcohol

Custom Q&A

What is the molecular formula of 3-Chloro-4-methoxybenzenemethanamine?

The molecular formula is C8H10ClNO.

What is the molecular weight of 3-Chloro-4-methoxybenzenemethanamine?

The molecular weight is 171.62 g/mol.

What is the IUPAC name of 3-Chloro-4-methoxybenzenemethanamine?

The IUPAC name is (3-chloro-4-methoxyphenyl)methanamine.

What is the InChI of 3-Chloro-4-methoxybenzenemethanamine?

The InChI is InChI=1S/C8H10ClNO/c1-11-8-3-2-6(5-10)4-7(8)9/h2-4H,5,10H2,1H3.

What is the InChIKey of 3-Chloro-4-methoxybenzenemethanamine?

The InChIKey is OCNMSDZALRAYEX-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Chloro-4-methoxybenzenemethanamine?

The canonical SMILES is COC1=C(C=C(C=C1)CN)Cl.

What is the CAS number of 3-Chloro-4-methoxybenzenemethanamine?

The CAS number is 115514-77-7.

What is the EC number of 3-Chloro-4-methoxybenzenemethanamine?

The EC number is 673-312-3.

What is the XLogP3 value of 3-Chloro-4-methoxybenzenemethanamine?

The XLogP3 value is 1.2.

Is 3-Chloro-4-methoxybenzenemethanamine a canonicalized compound?

Yes, 3-Chloro-4-methoxybenzenemethanamine is a canonicalized compound.