913836-03-0 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 3-Carboxy-4-methoxyphenylboronic acid is C8H9BO5.
The molecular weight of 3-Carboxy-4-methoxyphenylboronic acid is 195.97 g/mol.
The IUPAC name of 3-Carboxy-4-methoxyphenylboronic acid is 5-borono-2-methoxybenzoic acid.
The InChI key of 3-Carboxy-4-methoxyphenylboronic acid is YZKWFWNYFKBAHO-UHFFFAOYSA-N.
The canonical SMILES of 3-Carboxy-4-methoxyphenylboronic acid is B(C1=CC(=C(C=C1)OC)C(=O)O)(O)O.
The CAS number of 3-Carboxy-4-methoxyphenylboronic acid is 913836-12-1.
The hydrogen bond donor count of 3-Carboxy-4-methoxyphenylboronic acid is 3.
The hydrogen bond acceptor count of 3-Carboxy-4-methoxyphenylboronic acid is 5.
The rotatable bond count of 3-Carboxy-4-methoxyphenylboronic acid is 3.
Yes, 3-Carboxy-4-methoxyphenylboronic acid is a canonicalized compound.